C23H31N — CID 144776581
(3Z,5Z,8E)-9-(3-tert-butylphenyl)-5-methyl-N-prop-1-en-2-ylnona-1,3,5,8-tetraen-2-amine (PubChem CID 144776581) has the molecular formula C23H31N and a molecular weight of 321.51 g/mol. Its IUPAC name is (3Z,5Z,8E)-9-(3-tert-butylphenyl)-5-methyl-N-prop-1-en-2-ylnona-1,3,5,8-tetraen-2-amine.
| Compound Name | (3Z,5Z,8E)-9-(3-tert-butylphenyl)-5-methyl-N-prop-1-en-2-ylnona-1,3,5,8-tetraen-2-amine |
|---|---|
| PubChem CID | 144776581 |
| Molecular Formula | C23H31N |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | (3Z,5Z,8E)-9-(3-tert-butylphenyl)-5-methyl-N-prop-1-en-2-ylnona-1,3,5,8-tetraen-2-amine |
| SMILES | C=C(C)NC(=C)/C=C\C(C)=C/C/C=C/c1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H31N/c1-18(2)24-20(4)16-15-19(3)11-8-9-12-21-13-10-14-22(17-21)23(5,6)7/h9-17,24H,1,4,8H2,2-3,5-7H3/b12-9+,16-15-,19-11- |
| InChIKey | IDIQUDGPFIWVCA-NXKMTFAFSA-N |
| XLogP | 6.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|