C16H14S2 — CID 89070486
4-[(1E,3E)-4-(4-sulfanylphenyl)buta-1,3-dienyl]benzenethiol (PubChem CID 89070486) has the molecular formula C16H14S2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-[(1E,3E)-4-(4-sulfanylphenyl)buta-1,3-dienyl]benzenethiol.
| Compound Name | 4-[(1E,3E)-4-(4-sulfanylphenyl)buta-1,3-dienyl]benzenethiol |
|---|---|
| PubChem CID | 89070486 |
| Molecular Formula | C16H14S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 4-[(1E,3E)-4-(4-sulfanylphenyl)buta-1,3-dienyl]benzenethiol |
| SMILES | Sc1ccc(/C=C/C=C/c2ccc(S)cc2)cc1 |
| InChI | InChI=1S/C16H14S2/c17-15-9-5-13(6-10-15)3-1-2-4-14-7-11-16(18)12-8-14/h1-12,17-18H/b3-1+,4-2+ |
| InChIKey | ZKMBJMOKCHAITE-ZPUQHVIOSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|