C17H22O — CID 130384446
(Z)-5-[2-methyl-5-[(1E)-3-methylbuta-1,3-dienyl]phenyl]pent-4-en-1-ol (PubChem CID 130384446) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (Z)-5-[2-methyl-5-[(1E)-3-methylbuta-1,3-dienyl]phenyl]pent-4-en-1-ol.
| Compound Name | (Z)-5-[2-methyl-5-[(1E)-3-methylbuta-1,3-dienyl]phenyl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 130384446 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (Z)-5-[2-methyl-5-[(1E)-3-methylbuta-1,3-dienyl]phenyl]pent-4-en-1-ol |
| SMILES | C=C(C)/C=C/c1ccc(C)c(/C=C\CCCO)c1 |
| InChI | InChI=1S/C17H22O/c1-14(2)8-10-16-11-9-15(3)17(13-16)7-5-4-6-12-18/h5,7-11,13,18H,1,4,6,12H2,2-3H3/b7-5-,10-8+ |
| InChIKey | ZNCYLPSQYLBGSQ-SUTBWYPISA-N |
| XLogP | 4.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|