C23H35N2O2+ — CID 142382998
[(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]-hexylazanium (PubChem CID 142382998) has the molecular formula C23H35N2O2+ and a molecular weight of 371.55 g/mol. Its IUPAC name is [(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]-hexylazanium.
| Compound Name | [(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]-hexylazanium |
|---|---|
| PubChem CID | 142382998 |
| Molecular Formula | C23H35N2O2+ |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | [(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]-hexylazanium |
| SMILES | C=CC(/C=C/c1ccc(N(CCO)CCO)cc1)=C\C=[NH+]\CCCCCC |
| InChI | InChI=1S/C23H34N2O2/c1-3-5-6-7-15-24-16-14-21(4-2)8-9-22-10-12-23(13-11-22)25(17-19-26)18-20-27/h4,8-14,16,26-27H,2-3,5-7,15,17-20H2,1H3/p+1/b9-8+,21-14+,24-16+ |
| InChIKey | BAZDGKDQHKWRKS-KKVLYIDPSA-O |
| XLogP | 2.33 |
| TPSA | 57.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|