C21H29N2O2+ — CID 140682647
[(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]-but-3-enylazanium (PubChem CID 140682647) has the molecular formula C21H29N2O2+ and a molecular weight of 341.48 g/mol. Its IUPAC name is [(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]-but-3-enylazanium.
| Compound Name | [(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]-but-3-enylazanium |
|---|---|
| PubChem CID | 140682647 |
| Molecular Formula | C21H29N2O2+ |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | [(2E,4E)-5-[4-[bis(2-hydroxyethyl)amino]phenyl]-3-ethenylpenta-2,4-dienylidene]-but-3-enylazanium |
| SMILES | C=CCC/[NH+]=C/C=C(C=C)/C=C/c1ccc(N(CCO)CCO)cc1 |
| InChI | InChI=1S/C21H28N2O2/c1-3-5-13-22-14-12-19(4-2)6-7-20-8-10-21(11-9-20)23(15-17-24)16-18-25/h3-4,6-12,14,24-25H,1-2,5,13,15-18H2/p+1/b7-6+,19-12+,22-14+ |
| InChIKey | VHGDVCHTYSIJSC-RATAVPRISA-O |
| XLogP | 1.33 |
| TPSA | 57.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|