C37H62N2O4S — CID 88596526
N,N-didecyl-4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]aniline;ethyl sulfate (PubChem CID 88596526) has the molecular formula C37H62N2O4S and a molecular weight of 630.98 g/mol. Its IUPAC name is N,N-didecyl-4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]aniline;ethyl sulfate.
| Compound Name | N,N-didecyl-4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]aniline;ethyl sulfate |
|---|---|
| PubChem CID | 88596526 |
| Molecular Formula | C37H62N2O4S |
| Molecular Weight | 630.98 g/mol |
| Exact Mass | 630.44 |
| IUPAC Name | N,N-didecyl-4-[(E)-2-(1-ethylpyridin-1-ium-4-yl)ethenyl]aniline;ethyl sulfate |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)c1ccc(/C=C/c2cc[n+](CC)cc2)cc1.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C35H57N2.C2H6O4S/c1-4-7-9-11-13-15-17-19-29-37(30-20-18-16-14-12-10-8-5-2)35-25-23-33(24-26-35)21-22-34-27-31-36(6-3)32-28-34;1-2-6-7(3,4)5/h21-28,31-32H,4-20,29-30H2,1-3H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | APERWPJNBUGOAP-UHFFFAOYSA-M |
| XLogP | 9.74 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.98 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|