C27H38N3O3S2+ — CID 88945264
N-[3-[2-[(E)-2-[4-[bis(2-hydroxypropyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]propyl]-4-methyldithiolane-4-carboxamide (PubChem CID 88945264) has the molecular formula C27H38N3O3S2+ and a molecular weight of 516.75 g/mol. Its IUPAC name is N-[3-[2-[(E)-2-[4-[bis(2-hydroxypropyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]propyl]-4-methyldithiolane-4-carboxamide.
| Compound Name | N-[3-[2-[(E)-2-[4-[bis(2-hydroxypropyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]propyl]-4-methyldithiolane-4-carboxamide |
|---|---|
| PubChem CID | 88945264 |
| Molecular Formula | C27H38N3O3S2+ |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | N-[3-[2-[(E)-2-[4-[bis(2-hydroxypropyl)amino]phenyl]ethenyl]pyridin-1-ium-1-yl]propyl]-4-methyldithiolane-4-carboxamide |
| SMILES | CC(O)CN(CC(C)O)c1ccc(/C=C/c2cccc[n+]2CCCNC(=O)C2(C)CSSC2)cc1 |
| InChI | InChI=1S/C27H37N3O3S2/c1-21(31)17-30(18-22(2)32)25-12-9-23(10-13-25)8-11-24-7-4-5-15-29(24)16-6-14-28-26(33)27(3)19-34-35-20-27/h4-5,7-13,15,21-22,31-32H,6,14,16-20H2,1-3H3/p+1 |
| InChIKey | CBYDTJWMXIFECE-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|