C24H33N2O4S+ — CID 123246554
S-[5-[2-[2-(3,4,5-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]pentyl] N,N-dimethylcarbamothioate (PubChem CID 123246554) has the molecular formula C24H33N2O4S+ and a molecular weight of 445.61 g/mol. Its IUPAC name is S-[5-[2-[2-(3,4,5-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]pentyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[5-[2-[2-(3,4,5-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]pentyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 123246554 |
| Molecular Formula | C24H33N2O4S+ |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | S-[5-[2-[2-(3,4,5-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]pentyl] N,N-dimethylcarbamothioate |
| SMILES | COc1cc(C=Cc2cccc[n+]2CCCCCSC(=O)N(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C24H33N2O4S/c1-25(2)24(27)31-16-10-6-8-14-26-15-9-7-11-20(26)13-12-19-17-21(28-3)23(30-5)22(18-19)29-4/h7,9,11-13,15,17-18H,6,8,10,14,16H2,1-5H3/q+1 |
| InChIKey | ZFGMAYVMKQQRLS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|