C24H32NO4S+ — CID 123384905
S-[6-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]hexyl] ethanethioate (PubChem CID 123384905) has the molecular formula C24H32NO4S+ and a molecular weight of 430.59 g/mol. Its IUPAC name is S-[6-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]hexyl] ethanethioate.
| Compound Name | S-[6-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]hexyl] ethanethioate |
|---|---|
| PubChem CID | 123384905 |
| Molecular Formula | C24H32NO4S+ |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | S-[6-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]pyridin-1-ium-1-yl]hexyl] ethanethioate |
| SMILES | COc1cc(C=Cc2cc[n+](CCCCCCSC(C)=O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H32NO4S/c1-19(26)30-16-8-6-5-7-13-25-14-11-20(12-15-25)9-10-21-17-22(27-2)24(29-4)23(18-21)28-3/h9-12,14-15,17-18H,5-8,13,16H2,1-4H3/q+1 |
| InChIKey | XRVSDHOOWOKPCD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|