C38H46N2O6S2+2 — CID 89327878
4-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]-1-[2-[2-[4-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium (PubChem CID 89327878) has the molecular formula C38H46N2O6S2+2 and a molecular weight of 690.93 g/mol. Its IUPAC name is 4-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]-1-[2-[2-[4-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium.
| Compound Name | 4-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]-1-[2-[2-[4-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium |
|---|---|
| PubChem CID | 89327878 |
| Molecular Formula | C38H46N2O6S2+2 |
| Molecular Weight | 690.93 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | 4-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]-1-[2-[2-[4-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium |
| SMILES | COc1cc(/C=C(\C)c2cc[n+](CCSSCC[n+]3ccc(/C(C)=C/c4cc(OC)c(OC)c(OC)c4)cc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C38H46N2O6S2/c1-27(21-29-23-33(41-3)37(45-7)34(24-29)42-4)31-9-13-39(14-10-31)17-19-47-48-20-18-40-15-11-32(12-16-40)28(2)22-30-25-35(43-5)38(46-8)36(26-30)44-6/h9-16,21-26H,17-20H2,1-8H3/q+2/b27-21+,28-22+ |
| InChIKey | PZVMWEARBUMTPL-GPAWKIAZSA-N |
| XLogP | 7.52 |
| TPSA | 63.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.93 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|