C21H24O2 — CID 154074924
3-methoxy-2-(3-methylbut-3-enyl)-5-(2-phenylprop-1-enyl)phenol (PubChem CID 154074924) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-methoxy-2-(3-methylbut-3-enyl)-5-(2-phenylprop-1-enyl)phenol.
| Compound Name | 3-methoxy-2-(3-methylbut-3-enyl)-5-(2-phenylprop-1-enyl)phenol |
|---|---|
| PubChem CID | 154074924 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 3-methoxy-2-(3-methylbut-3-enyl)-5-(2-phenylprop-1-enyl)phenol |
| SMILES | C=C(C)CCc1c(O)cc(C=C(C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H24O2/c1-15(2)10-11-19-20(22)13-17(14-21(19)23-4)12-16(3)18-8-6-5-7-9-18/h5-9,12-14,22H,1,10-11H2,2-4H3 |
| InChIKey | JYFAWDLHRDJLQG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|