C20H28O2 — CID 154076842
5-(2-cyclohexylethenyl)-3-methoxy-2-(3-methylbut-3-enyl)phenol (PubChem CID 154076842) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 5-(2-cyclohexylethenyl)-3-methoxy-2-(3-methylbut-3-enyl)phenol.
| Compound Name | 5-(2-cyclohexylethenyl)-3-methoxy-2-(3-methylbut-3-enyl)phenol |
|---|---|
| PubChem CID | 154076842 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 5-(2-cyclohexylethenyl)-3-methoxy-2-(3-methylbut-3-enyl)phenol |
| SMILES | C=C(C)CCc1c(O)cc(C=CC2CCCCC2)cc1OC |
| InChI | InChI=1S/C20H28O2/c1-15(2)9-12-18-19(21)13-17(14-20(18)22-3)11-10-16-7-5-4-6-8-16/h10-11,13-14,16,21H,1,4-9,12H2,2-3H3 |
| InChIKey | SYBXOQGSKYATSY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|