C23H26O6 — CID 154074952
6-[2-(2,6-dimethoxyphenyl)ethenyl]-2-hydroxy-4-methoxy-3-(3-methylbut-3-enyl)benzoic acid (PubChem CID 154074952) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is 6-[2-(2,6-dimethoxyphenyl)ethenyl]-2-hydroxy-4-methoxy-3-(3-methylbut-3-enyl)benzoic acid.
| Compound Name | 6-[2-(2,6-dimethoxyphenyl)ethenyl]-2-hydroxy-4-methoxy-3-(3-methylbut-3-enyl)benzoic acid |
|---|---|
| PubChem CID | 154074952 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 6-[2-(2,6-dimethoxyphenyl)ethenyl]-2-hydroxy-4-methoxy-3-(3-methylbut-3-enyl)benzoic acid |
| SMILES | C=C(C)CCc1c(OC)cc(C=Cc2c(OC)cccc2OC)c(C(=O)O)c1O |
| InChI | InChI=1S/C23H26O6/c1-14(2)9-11-17-20(29-5)13-15(21(22(17)24)23(25)26)10-12-16-18(27-3)7-6-8-19(16)28-4/h6-8,10,12-13,24H,1,9,11H2,2-5H3,(H,25,26) |
| InChIKey | QZWOBYXEKAZHKV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|