C23H26O4 — CID 123394787
2-hydroxy-4-methoxy-3-(3-methylbutyl)-6-(4-phenylbuta-1,3-dienyl)benzoic acid (PubChem CID 123394787) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-hydroxy-4-methoxy-3-(3-methylbutyl)-6-(4-phenylbuta-1,3-dienyl)benzoic acid.
| Compound Name | 2-hydroxy-4-methoxy-3-(3-methylbutyl)-6-(4-phenylbuta-1,3-dienyl)benzoic acid |
|---|---|
| PubChem CID | 123394787 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-hydroxy-4-methoxy-3-(3-methylbutyl)-6-(4-phenylbuta-1,3-dienyl)benzoic acid |
| SMILES | COc1cc(C=CC=Cc2ccccc2)c(C(=O)O)c(O)c1CCC(C)C |
| InChI | InChI=1S/C23H26O4/c1-16(2)13-14-19-20(27-3)15-18(21(22(19)24)23(25)26)12-8-7-11-17-9-5-4-6-10-17/h4-12,15-16,24H,13-14H2,1-3H3,(H,25,26) |
| InChIKey | XKZGBAIMLPDHJR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|