C23H22O7 — CID 154076809
4-methoxy-3-(3-methylbut-3-enyl)-2-oxalooxy-6-(2-phenylethenyl)benzoic acid (PubChem CID 154076809) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is 4-methoxy-3-(3-methylbut-3-enyl)-2-oxalooxy-6-(2-phenylethenyl)benzoic acid.
| Compound Name | 4-methoxy-3-(3-methylbut-3-enyl)-2-oxalooxy-6-(2-phenylethenyl)benzoic acid |
|---|---|
| PubChem CID | 154076809 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4-methoxy-3-(3-methylbut-3-enyl)-2-oxalooxy-6-(2-phenylethenyl)benzoic acid |
| SMILES | C=C(C)CCc1c(OC)cc(C=Cc2ccccc2)c(C(=O)O)c1OC(=O)C(=O)O |
| InChI | InChI=1S/C23H22O7/c1-14(2)9-12-17-18(29-3)13-16(11-10-15-7-5-4-6-8-15)19(21(24)25)20(17)30-23(28)22(26)27/h4-8,10-11,13H,1,9,12H2,2-3H3,(H,24,25)(H,26,27) |
| InChIKey | NHSKELSIDJATBT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|