C22H23FO4 — CID 141383209
methyl 6-[(E)-2-(2-fluorophenyl)ethenyl]-2-hydroxy-4-methoxy-3-(3-methylbut-3-enyl)benzoate (PubChem CID 141383209) has the molecular formula C22H23FO4 and a molecular weight of 370.42 g/mol. Its IUPAC name is methyl 6-[(E)-2-(2-fluorophenyl)ethenyl]-2-hydroxy-4-methoxy-3-(3-methylbut-3-enyl)benzoate.
| Compound Name | methyl 6-[(E)-2-(2-fluorophenyl)ethenyl]-2-hydroxy-4-methoxy-3-(3-methylbut-3-enyl)benzoate |
|---|---|
| PubChem CID | 141383209 |
| Molecular Formula | C22H23FO4 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | methyl 6-[(E)-2-(2-fluorophenyl)ethenyl]-2-hydroxy-4-methoxy-3-(3-methylbut-3-enyl)benzoate |
| SMILES | C=C(C)CCc1c(OC)cc(/C=C/c2ccccc2F)c(C(=O)OC)c1O |
| InChI | InChI=1S/C22H23FO4/c1-14(2)9-12-17-19(26-3)13-16(20(21(17)24)22(25)27-4)11-10-15-7-5-6-8-18(15)23/h5-8,10-11,13,24H,1,9,12H2,2-4H3/b11-10+ |
| InChIKey | JXQUJQFTYUDJCV-ZHACJKMWSA-N |
| XLogP | 5.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|