C22H24O5 — CID 154074948
2-hydroxy-4-methoxy-6-[2-(4-methoxyphenyl)ethenyl]-3-(3-methylbut-3-enyl)benzoic acid (PubChem CID 154074948) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-hydroxy-4-methoxy-6-[2-(4-methoxyphenyl)ethenyl]-3-(3-methylbut-3-enyl)benzoic acid.
| Compound Name | 2-hydroxy-4-methoxy-6-[2-(4-methoxyphenyl)ethenyl]-3-(3-methylbut-3-enyl)benzoic acid |
|---|---|
| PubChem CID | 154074948 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-hydroxy-4-methoxy-6-[2-(4-methoxyphenyl)ethenyl]-3-(3-methylbut-3-enyl)benzoic acid |
| SMILES | C=C(C)CCc1c(OC)cc(C=Cc2ccc(OC)cc2)c(C(=O)O)c1O |
| InChI | InChI=1S/C22H24O5/c1-14(2)5-12-18-19(27-4)13-16(20(21(18)23)22(24)25)9-6-15-7-10-17(26-3)11-8-15/h6-11,13,23H,1,5,12H2,2-4H3,(H,24,25) |
| InChIKey | KFSVWKDZBYBCMH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|