C22H24O7 — CID 175058461
4-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methoxy]-4-oxobutanoic acid (PubChem CID 175058461) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is 4-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175058461 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methoxy]-4-oxobutanoic acid |
| SMILES | COc1ccc(C=Cc2cc(OC)cc(OC)c2COC(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C22H24O7/c1-26-17-8-5-15(6-9-17)4-7-16-12-18(27-2)13-20(28-3)19(16)14-29-22(25)11-10-21(23)24/h4-9,12-13H,10-11,14H2,1-3H3,(H,23,24) |
| InChIKey | BJALTLJZNMCLIR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|