C28H30ClNO4 — CID 175294279
4-chloro-N-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methyl]-N-phenylbutanamide (PubChem CID 175294279) has the molecular formula C28H30ClNO4 and a molecular weight of 480.00 g/mol. Its IUPAC name is 4-chloro-N-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methyl]-N-phenylbutanamide.
| Compound Name | 4-chloro-N-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methyl]-N-phenylbutanamide |
|---|---|
| PubChem CID | 175294279 |
| Molecular Formula | C28H30ClNO4 |
| Molecular Weight | 480.00 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 4-chloro-N-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methyl]-N-phenylbutanamide |
| SMILES | COc1ccc(C=Cc2cc(OC)cc(OC)c2CN(C(=O)CCCCl)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30ClNO4/c1-32-24-15-12-21(13-16-24)11-14-22-18-25(33-2)19-27(34-3)26(22)20-30(28(31)10-7-17-29)23-8-5-4-6-9-23/h4-6,8-9,11-16,18-19H,7,10,17,20H2,1-3H3 |
| InChIKey | YFJHMHPIEXBFRG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.00 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|