C28H25FO4 — CID 57402868
(1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2-fluorophenyl)penta-1,4-dien-3-one (PubChem CID 57402868) has the molecular formula C28H25FO4 and a molecular weight of 444.50 g/mol. Its IUPAC name is (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2-fluorophenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2-fluorophenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 57402868 |
| Molecular Formula | C28H25FO4 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (1E,4E)-1-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-5-(2-fluorophenyl)penta-1,4-dien-3-one |
| SMILES | COc1ccc(/C=C/c2cc(OC)cc(OC)c2/C=C/C(=O)/C=C/c2ccccc2F)cc1 |
| InChI | InChI=1S/C28H25FO4/c1-31-24-15-9-20(10-16-24)8-11-22-18-25(32-2)19-28(33-3)26(22)17-14-23(30)13-12-21-6-4-5-7-27(21)29/h4-19H,1-3H3/b11-8+,13-12+,17-14+ |
| InChIKey | RMKQTQVFCUESQF-BGPZFKCKSA-N |
| XLogP | 6.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|