C32H36O5 — CID 54581750
(E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-hexoxyphenyl)prop-2-en-1-one (PubChem CID 54581750) has the molecular formula C32H36O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-hexoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-hexoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54581750 |
| Molecular Formula | C32H36O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-hexoxyphenyl)prop-2-en-1-one |
| SMILES | CCCCCCOc1ccc(C(=O)/C=C/c2c(/C=C/c3ccc(OC)cc3)cc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C32H36O5/c1-5-6-7-8-21-37-28-17-13-25(14-18-28)31(33)20-19-30-26(22-29(35-3)23-32(30)36-4)12-9-24-10-15-27(34-2)16-11-24/h9-20,22-23H,5-8,21H2,1-4H3/b12-9+,20-19+ |
| InChIKey | FDRCDAFGYIRZCM-NKLQRROOSA-N |
| XLogP | 7.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|