C28H28O5 — CID 54583562
(E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-ethoxyphenyl)prop-2-en-1-one (PubChem CID 54583562) has the molecular formula C28H28O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-ethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-ethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54583562 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-ethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C(=O)/C=C/c2c(/C=C/c3ccc(OC)cc3)cc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C28H28O5/c1-5-33-24-14-10-21(11-15-24)27(29)17-16-26-22(18-25(31-3)19-28(26)32-4)9-6-20-7-12-23(30-2)13-8-20/h6-19H,5H2,1-4H3/b9-6+,17-16+ |
| InChIKey | YUCCVIOMAUWSKV-OUWLFTCQSA-N |
| XLogP | 6.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|