C27H26O4 — CID 54583718
(E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(2-methylphenyl)prop-2-en-1-one (PubChem CID 54583718) has the molecular formula C27H26O4 and a molecular weight of 414.50 g/mol. Its IUPAC name is (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(2-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(2-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54583718 |
| Molecular Formula | C27H26O4 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(2-methylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/c2cc(OC)cc(OC)c2/C=C/C(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C27H26O4/c1-19-7-5-6-8-24(19)26(28)16-15-25-21(17-23(30-3)18-27(25)31-4)12-9-20-10-13-22(29-2)14-11-20/h5-18H,1-4H3/b12-9+,16-15+ |
| InChIKey | LTIQDIDHESWGBE-JDHQLRNLSA-N |
| XLogP | 6.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|