C29H23BrO6 — CID 122194605
7-bromo-3-[(E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]prop-2-enoyl]chromen-2-one (PubChem CID 122194605) has the molecular formula C29H23BrO6 and a molecular weight of 547.40 g/mol. Its IUPAC name is 7-bromo-3-[(E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]prop-2-enoyl]chromen-2-one.
| Compound Name | 7-bromo-3-[(E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]prop-2-enoyl]chromen-2-one |
|---|---|
| PubChem CID | 122194605 |
| Molecular Formula | C29H23BrO6 |
| Molecular Weight | 547.40 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | 7-bromo-3-[(E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]prop-2-enoyl]chromen-2-one |
| SMILES | COc1ccc(/C=C/c2cc(OC)cc(OC)c2/C=C/C(=O)c2cc3ccc(Br)cc3oc2=O)cc1 |
| InChI | InChI=1S/C29H23BrO6/c1-33-22-10-5-18(6-11-22)4-7-19-14-23(34-2)17-28(35-3)24(19)12-13-26(31)25-15-20-8-9-21(30)16-27(20)36-29(25)32/h4-17H,1-3H3/b7-4+,13-12+ |
| InChIKey | VUIHXXXAELJOFV-RTYMFESYSA-N |
| XLogP | 6.65 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.40 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|