C28H25NO7 — CID 57397686
[4-[(1E,4E)-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-3-oxopenta-1,4-dienyl]phenyl] nitrate (PubChem CID 57397686) has the molecular formula C28H25NO7 and a molecular weight of 487.51 g/mol. Its IUPAC name is [4-[(1E,4E)-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-3-oxopenta-1,4-dienyl]phenyl] nitrate.
| Compound Name | [4-[(1E,4E)-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-3-oxopenta-1,4-dienyl]phenyl] nitrate |
|---|---|
| PubChem CID | 57397686 |
| Molecular Formula | C28H25NO7 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | [4-[(1E,4E)-5-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-3-oxopenta-1,4-dienyl]phenyl] nitrate |
| SMILES | COc1ccc(/C=C/c2cc(OC)cc(OC)c2/C=C/C(=O)/C=C/c2ccc(O[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H25NO7/c1-33-24-13-6-20(7-14-24)4-10-22-18-26(34-2)19-28(35-3)27(22)17-12-23(30)11-5-21-8-15-25(16-9-21)36-29(31)32/h4-19H,1-3H3/b10-4+,11-5+,17-12+ |
| InChIKey | ISSXDRUKIHIHSN-KMVVSNBISA-N |
| XLogP | 5.75 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|