C23H26N2O5 — CID 164623572
N-[4-[(E)-2-[3,5-dimethoxy-2-[(E)-2-nitroethenyl]phenyl]ethenyl]phenyl]pentanamide (PubChem CID 164623572) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[4-[(E)-2-[3,5-dimethoxy-2-[(E)-2-nitroethenyl]phenyl]ethenyl]phenyl]pentanamide.
| Compound Name | N-[4-[(E)-2-[3,5-dimethoxy-2-[(E)-2-nitroethenyl]phenyl]ethenyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 164623572 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[4-[(E)-2-[3,5-dimethoxy-2-[(E)-2-nitroethenyl]phenyl]ethenyl]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(/C=C/c2cc(OC)cc(OC)c2/C=C/[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H26N2O5/c1-4-5-6-23(26)24-19-11-8-17(9-12-19)7-10-18-15-20(29-2)16-22(30-3)21(18)13-14-25(27)28/h7-16H,4-6H2,1-3H3,(H,24,26)/b10-7+,14-13+ |
| InChIKey | BLDUPHGOSCOJCH-CDITWBNYSA-N |
| XLogP | 5.25 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|