C21H27N3O4S — CID 3193307
N-[2,5-dimethoxy-4-[(4-methoxyphenyl)carbamothioylamino]phenyl]pentanamide (PubChem CID 3193307) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-[(4-methoxyphenyl)carbamothioylamino]phenyl]pentanamide.
| Compound Name | N-[2,5-dimethoxy-4-[(4-methoxyphenyl)carbamothioylamino]phenyl]pentanamide |
|---|---|
| PubChem CID | 3193307 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-[2,5-dimethoxy-4-[(4-methoxyphenyl)carbamothioylamino]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cc(OC)c(NC(=S)Nc2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C21H27N3O4S/c1-5-6-7-20(25)23-16-12-19(28-4)17(13-18(16)27-3)24-21(29)22-14-8-10-15(26-2)11-9-14/h8-13H,5-7H2,1-4H3,(H,23,25)(H2,22,24,29) |
| InChIKey | SBBSHRAHHNTYQK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|