C20H19ClN2O5 — CID 164611020
2-chloro-N-[4-[(E)-2-[3,5-dimethoxy-2-[(E)-2-nitroethenyl]phenyl]ethenyl]phenyl]acetamide (PubChem CID 164611020) has the molecular formula C20H19ClN2O5 and a molecular weight of 402.83 g/mol. Its IUPAC name is 2-chloro-N-[4-[(E)-2-[3,5-dimethoxy-2-[(E)-2-nitroethenyl]phenyl]ethenyl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-[(E)-2-[3,5-dimethoxy-2-[(E)-2-nitroethenyl]phenyl]ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 164611020 |
| Molecular Formula | C20H19ClN2O5 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-chloro-N-[4-[(E)-2-[3,5-dimethoxy-2-[(E)-2-nitroethenyl]phenyl]ethenyl]phenyl]acetamide |
| SMILES | COc1cc(/C=C/c2ccc(NC(=O)CCl)cc2)c(/C=C/[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C20H19ClN2O5/c1-27-17-11-15(18(9-10-23(25)26)19(12-17)28-2)6-3-14-4-7-16(8-5-14)22-20(24)13-21/h3-12H,13H2,1-2H3,(H,22,24)/b6-3+,10-9+ |
| InChIKey | XJRZRCMZZKCGAB-YGTBBBQQSA-N |
| XLogP | 4.30 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|