C26H31NO4 — CID 71652530
(E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-methylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 71652530) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-methylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-methylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71652530 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (E)-3-[2,4-dimethoxy-6-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-1-(4-methylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/c2cc(OC)cc(OC)c2/C=C/C(=O)N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C26H31NO4/c1-19-13-15-27(16-14-19)26(28)12-11-24-21(17-23(30-3)18-25(24)31-4)8-5-20-6-9-22(29-2)10-7-20/h5-12,17-19H,13-16H2,1-4H3/b8-5+,12-11+ |
| InChIKey | IYWKSVRNQXLVKW-CQYWEGEGSA-N |
| XLogP | 5.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|