C21H17BrO6 — CID 4670842
6-bromo-3-[3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]chromen-2-one (PubChem CID 4670842) has the molecular formula C21H17BrO6 and a molecular weight of 445.27 g/mol. Its IUPAC name is 6-bromo-3-[3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]chromen-2-one.
| Compound Name | 6-bromo-3-[3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]chromen-2-one |
|---|---|
| PubChem CID | 4670842 |
| Molecular Formula | C21H17BrO6 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 6-bromo-3-[3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]chromen-2-one |
| SMILES | COc1cc(OC)c(OC)cc1C=CC(=O)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C21H17BrO6/c1-25-18-11-20(27-3)19(26-2)10-12(18)4-6-16(23)15-9-13-8-14(22)5-7-17(13)28-21(15)24/h4-11H,1-3H3 |
| InChIKey | JYBQPHKUJDBQDS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|