C34H32O4 — CID 175032827
[4-(2-phenylpropan-2-yl)phenyl] (E)-3-[2,4-dimethoxy-6-[(E)-2-phenylethenyl]phenyl]prop-2-enoate (PubChem CID 175032827) has the molecular formula C34H32O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is [4-(2-phenylpropan-2-yl)phenyl] (E)-3-[2,4-dimethoxy-6-[(E)-2-phenylethenyl]phenyl]prop-2-enoate.
| Compound Name | [4-(2-phenylpropan-2-yl)phenyl] (E)-3-[2,4-dimethoxy-6-[(E)-2-phenylethenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 175032827 |
| Molecular Formula | C34H32O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [4-(2-phenylpropan-2-yl)phenyl] (E)-3-[2,4-dimethoxy-6-[(E)-2-phenylethenyl]phenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/c2ccccc2)c(/C=C/C(=O)Oc2ccc(C(C)(C)c3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C34H32O4/c1-34(2,27-13-9-6-10-14-27)28-17-19-29(20-18-28)38-33(35)22-21-31-26(16-15-25-11-7-5-8-12-25)23-30(36-3)24-32(31)37-4/h5-24H,1-4H3/b16-15+,22-21+ |
| InChIKey | PRNVKNPPYQOMQJ-DYUKIBRESA-N |
| XLogP | 7.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|