C26H26ClNO4 — CID 175294249
2-chloro-N-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methyl]-N-phenylacetamide (PubChem CID 175294249) has the molecular formula C26H26ClNO4 and a molecular weight of 451.95 g/mol. Its IUPAC name is 2-chloro-N-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methyl]-N-phenylacetamide.
| Compound Name | 2-chloro-N-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 175294249 |
| Molecular Formula | C26H26ClNO4 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-chloro-N-[[2,4-dimethoxy-6-[2-(4-methoxyphenyl)ethenyl]phenyl]methyl]-N-phenylacetamide |
| SMILES | COc1ccc(C=Cc2cc(OC)cc(OC)c2CN(C(=O)CCl)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26ClNO4/c1-30-22-13-10-19(11-14-22)9-12-20-15-23(31-2)16-25(32-3)24(20)18-28(26(29)17-27)21-7-5-4-6-8-21/h4-16H,17-18H2,1-3H3 |
| InChIKey | MGEYGRSTNROENB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|