C31H28INO2 — CID 175294252
4-iodo-N-[[2-[2-(4-methoxyphenyl)ethenyl]-4,6-dimethylphenyl]methyl]-N-phenylbenzamide (PubChem CID 175294252) has the molecular formula C31H28INO2 and a molecular weight of 573.47 g/mol. Its IUPAC name is 4-iodo-N-[[2-[2-(4-methoxyphenyl)ethenyl]-4,6-dimethylphenyl]methyl]-N-phenylbenzamide.
| Compound Name | 4-iodo-N-[[2-[2-(4-methoxyphenyl)ethenyl]-4,6-dimethylphenyl]methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 175294252 |
| Molecular Formula | C31H28INO2 |
| Molecular Weight | 573.47 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | 4-iodo-N-[[2-[2-(4-methoxyphenyl)ethenyl]-4,6-dimethylphenyl]methyl]-N-phenylbenzamide |
| SMILES | COc1ccc(C=Cc2cc(C)cc(C)c2CN(C(=O)c2ccc(I)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28INO2/c1-22-19-23(2)30(26(20-22)12-9-24-10-17-29(35-3)18-11-24)21-33(28-7-5-4-6-8-28)31(34)25-13-15-27(32)16-14-25/h4-20H,21H2,1-3H3 |
| InChIKey | ABVMXIXYUFSCAL-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.47 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|