C26H25N3O3S — CID 17222112
N-ethyl-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-phenylbenzamide (PubChem CID 17222112) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-ethyl-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-phenylbenzamide.
| Compound Name | N-ethyl-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 17222112 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-ethyl-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-phenylbenzamide |
| SMILES | CCN(C(=O)c1cccc(NC(=S)NC(=O)/C=C/c2ccc(OC)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C26H25N3O3S/c1-3-29(22-10-5-4-6-11-22)25(31)20-8-7-9-21(18-20)27-26(33)28-24(30)17-14-19-12-15-23(32-2)16-13-19/h4-18H,3H2,1-2H3,(H2,27,28,30,33)/b17-14+ |
| InChIKey | KOSFORGMQXXFGS-SAPNQHFASA-N |
| XLogP | 4.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|