C26H24N2O4 — CID 1422005
4-methoxy-N-(3-methoxyphenyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide (PubChem CID 1422005) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-methoxy-N-(3-methoxyphenyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide.
| Compound Name | 4-methoxy-N-(3-methoxyphenyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 1422005 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 4-methoxy-N-(3-methoxyphenyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide |
| SMILES | COc1ccc(C(=O)N(Cc2cc3cccc(C)c3[nH]c2=O)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C26H24N2O4/c1-17-6-4-7-19-14-20(25(29)27-24(17)19)16-28(21-8-5-9-23(15-21)32-3)26(30)18-10-12-22(31-2)13-11-18/h4-15H,16H2,1-3H3,(H,27,29) |
| InChIKey | FTAGUCYYZOHWGB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |