C25H21N3O5 — CID 1416098
N-(2-methoxyphenyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-4-nitrobenzamide (PubChem CID 1416098) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-4-nitrobenzamide.
| Compound Name | N-(2-methoxyphenyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 1416098 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-(2-methoxyphenyl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-4-nitrobenzamide |
| SMILES | COc1ccccc1N(Cc1cc2cccc(C)c2[nH]c1=O)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H21N3O5/c1-16-6-5-7-18-14-19(24(29)26-23(16)18)15-27(21-8-3-4-9-22(21)33-2)25(30)17-10-12-20(13-11-17)28(31)32/h3-14H,15H2,1-2H3,(H,26,29) |
| InChIKey | QBQDTGHRHZSQNH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|