C24H21N3O2 — CID 3682103
N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-methylphenyl)pyridine-4-carboxamide (PubChem CID 3682103) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-methylphenyl)pyridine-4-carboxamide.
| Compound Name | N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-methylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 3682103 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-methylphenyl)pyridine-4-carboxamide |
| SMILES | Cc1ccccc1N(Cc1cc2cccc(C)c2[nH]c1=O)C(=O)c1ccncc1 |
| InChI | InChI=1S/C24H21N3O2/c1-16-6-3-4-9-21(16)27(24(29)18-10-12-25-13-11-18)15-20-14-19-8-5-7-17(2)22(19)26-23(20)28/h3-14H,15H2,1-2H3,(H,26,28) |
| InChIKey | ZQCCZAASMHKQIL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |