C22H26O4 — CID 123629568
2-hydroxy-4-methoxy-3-(3-methylbutyl)-6-(3-phenylprop-1-enyl)benzoic acid (PubChem CID 123629568) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-hydroxy-4-methoxy-3-(3-methylbutyl)-6-(3-phenylprop-1-enyl)benzoic acid.
| Compound Name | 2-hydroxy-4-methoxy-3-(3-methylbutyl)-6-(3-phenylprop-1-enyl)benzoic acid |
|---|---|
| PubChem CID | 123629568 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-hydroxy-4-methoxy-3-(3-methylbutyl)-6-(3-phenylprop-1-enyl)benzoic acid |
| SMILES | COc1cc(C=CCc2ccccc2)c(C(=O)O)c(O)c1CCC(C)C |
| InChI | InChI=1S/C22H26O4/c1-15(2)12-13-18-19(26-3)14-17(20(21(18)23)22(24)25)11-7-10-16-8-5-4-6-9-16/h4-9,11,14-15,23H,10,12-13H2,1-3H3,(H,24,25) |
| InChIKey | ZQQIFUMTURCREO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |