C40H48N4O4S2+2 — CID 123900186
4-[4-[2-(2-methoxyphenyl)ethenyl]pyridin-1-ium-1-yl]-N-[2-[2-[4-[4-[2-(2-methoxyphenyl)ethenyl]pyridin-1-ium-1-yl]butanoylamino]ethyldisulfanyl]ethyl]butanamide (PubChem CID 123900186) has the molecular formula C40H48N4O4S2+2 and a molecular weight of 712.98 g/mol. Its IUPAC name is 4-[4-[2-(2-methoxyphenyl)ethenyl]pyridin-1-ium-1-yl]-N-[2-[2-[4-[4-[2-(2-methoxyphenyl)ethenyl]pyridin-1-ium-1-yl]butanoylamino]ethyldisulfanyl]ethyl]butanamide.
| Compound Name | 4-[4-[2-(2-methoxyphenyl)ethenyl]pyridin-1-ium-1-yl]-N-[2-[2-[4-[4-[2-(2-methoxyphenyl)ethenyl]pyridin-1-ium-1-yl]butanoylamino]ethyldisulfanyl]ethyl]butanamide |
|---|---|
| PubChem CID | 123900186 |
| Molecular Formula | C40H48N4O4S2+2 |
| Molecular Weight | 712.98 g/mol |
| Exact Mass | 712.31 |
| IUPAC Name | 4-[4-[2-(2-methoxyphenyl)ethenyl]pyridin-1-ium-1-yl]-N-[2-[2-[4-[4-[2-(2-methoxyphenyl)ethenyl]pyridin-1-ium-1-yl]butanoylamino]ethyldisulfanyl]ethyl]butanamide |
| SMILES | COc1ccccc1C=Cc1cc[n+](CCCC(=O)NCCSSCCNC(=O)CCC[n+]2ccc(C=Cc3ccccc3OC)cc2)cc1 |
| InChI | InChI=1S/C40H46N4O4S2/c1-47-37-11-5-3-9-35(37)17-15-33-19-27-43(28-20-33)25-7-13-39(45)41-23-31-49-50-32-24-42-40(46)14-8-26-44-29-21-34(22-30-44)16-18-36-10-4-6-12-38(36)48-2/h3-6,9-12,15-22,27-30H,7-8,13-14,23-26,31-32H2,1-2H3/p+2 |
| InChIKey | FFXCQGOXHPZPRH-UHFFFAOYSA-P |
| XLogP | 6.49 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.98 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|