C18H20NO4+ — CID 123840314
1-(1-methylpyridin-1-ium-3-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 123840314) has the molecular formula C18H20NO4+ and a molecular weight of 314.36 g/mol. Its IUPAC name is 1-(1-methylpyridin-1-ium-3-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(1-methylpyridin-1-ium-3-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123840314 |
| Molecular Formula | C18H20NO4+ |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-(1-methylpyridin-1-ium-3-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2ccc[n+](C)c2)c(OC)c1OC |
| InChI | InChI=1S/C18H20NO4/c1-19-11-5-6-14(12-19)15(20)9-7-13-8-10-16(21-2)18(23-4)17(13)22-3/h5-12H,1-4H3/q+1 |
| InChIKey | AHSWEODUAAJBGT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|