C14H12Cl2N+ — CID 4172203
2-[2-(2,6-dichlorophenyl)ethenyl]-1-methylpyridin-1-ium (PubChem CID 4172203) has the molecular formula C14H12Cl2N+ and a molecular weight of 265.16 g/mol. Its IUPAC name is 2-[2-(2,6-dichlorophenyl)ethenyl]-1-methylpyridin-1-ium.
| Compound Name | 2-[2-(2,6-dichlorophenyl)ethenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 4172203 |
| Molecular Formula | C14H12Cl2N+ |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-[2-(2,6-dichlorophenyl)ethenyl]-1-methylpyridin-1-ium |
| SMILES | C[n+]1ccccc1C=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H12Cl2N/c1-17-10-3-2-5-11(17)8-9-12-13(15)6-4-7-14(12)16/h2-10H,1H3/q+1 |
| InChIKey | HILYGOLOXTXUTE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|