C27H26N2O5 — CID 134913406
(Z)-N-[1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]benzenecarboximidate (PubChem CID 134913406) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is (Z)-N-[1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]benzenecarboximidate.
| Compound Name | (Z)-N-[1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 134913406 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (Z)-N-[1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]benzenecarboximidate |
| SMILES | COc1ccc(-c2c3cc(OC)c(OC)cc3cc(C)[n+]2/N=C(\[O-])c2ccccc2)cc1OC |
| InChI | InChI=1S/C27H26N2O5/c1-17-13-20-15-24(33-4)25(34-5)16-21(20)26(19-11-12-22(31-2)23(14-19)32-3)29(17)28-27(30)18-9-7-6-8-10-18/h6-16H,1-5H3 |
| InChIKey | VRTBKWSQFDJGNY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|