C26H22FN5O2 — CID 135406524
[3-[1-(4-fluorophenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]-1H-1,2,4-triazol-5-yl]-phenylazanide (PubChem CID 135406524) has the molecular formula C26H22FN5O2 and a molecular weight of 455.49 g/mol. Its IUPAC name is [3-[1-(4-fluorophenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]-1H-1,2,4-triazol-5-yl]-phenylazanide.
| Compound Name | [3-[1-(4-fluorophenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]-1H-1,2,4-triazol-5-yl]-phenylazanide |
|---|---|
| PubChem CID | 135406524 |
| Molecular Formula | C26H22FN5O2 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | [3-[1-(4-fluorophenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]-1H-1,2,4-triazol-5-yl]-phenylazanide |
| SMILES | COc1cc2cc(C)[n+](-c3n[nH]c([N-]c4ccccc4)n3)c(-c3ccc(F)cc3)c2cc1OC |
| InChI | InChI=1S/C26H22FN5O2/c1-16-13-18-14-22(33-2)23(34-3)15-21(18)24(17-9-11-19(27)12-10-17)32(16)26-29-25(30-31-26)28-20-7-5-4-6-8-20/h4-15H,1-3H3,(H-,28,29,30,31) |
| InChIKey | PJHBDIYFZOWVJF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|