C20H18ClN4O2+ — CID 11794196
1-(2-chlorophenyl)-6,7-dimethoxy-3-methyl-2-(1H-1,2,4-triazol-5-yl)isoquinolin-2-ium (PubChem CID 11794196) has the molecular formula C20H18ClN4O2+ and a molecular weight of 381.84 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-6,7-dimethoxy-3-methyl-2-(1H-1,2,4-triazol-5-yl)isoquinolin-2-ium.
| Compound Name | 1-(2-chlorophenyl)-6,7-dimethoxy-3-methyl-2-(1H-1,2,4-triazol-5-yl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 11794196 |
| Molecular Formula | C20H18ClN4O2+ |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-(2-chlorophenyl)-6,7-dimethoxy-3-methyl-2-(1H-1,2,4-triazol-5-yl)isoquinolin-2-ium |
| SMILES | COc1cc2cc(C)[n+](-c3ncn[nH]3)c(-c3ccccc3Cl)c2cc1OC |
| InChI | InChI=1S/C20H18ClN4O2/c1-12-8-13-9-17(26-2)18(27-3)10-15(13)19(14-6-4-5-7-16(14)21)25(12)20-22-11-23-24-20/h4-11H,1-3H3,(H,22,23,24)/q+1 |
| InChIKey | MERURVAYPVNRNO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|