C26H27ClN5O2+ — CID 10814433
5-[1-(2-chlorophenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]-N,N-bis(prop-2-enyl)-1H-1,2,4-triazol-3-amine (PubChem CID 10814433) has the molecular formula C26H27ClN5O2+ and a molecular weight of 476.99 g/mol. Its IUPAC name is 5-[1-(2-chlorophenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]-N,N-bis(prop-2-enyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[1-(2-chlorophenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]-N,N-bis(prop-2-enyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 10814433 |
| Molecular Formula | C26H27ClN5O2+ |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 5-[1-(2-chlorophenyl)-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]-N,N-bis(prop-2-enyl)-1H-1,2,4-triazol-3-amine |
| SMILES | C=CCN(CC=C)c1n[nH]c(-[n+]2c(C)cc3cc(OC)c(OC)cc3c2-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C26H27ClN5O2/c1-6-12-31(13-7-2)25-28-26(30-29-25)32-17(3)14-18-15-22(33-4)23(34-5)16-20(18)24(32)19-10-8-9-11-21(19)27/h6-11,14-16H,1-2,12-13H2,3-5H3,(H,28,29,30)/q+1 |
| InChIKey | PSPJMMNTYOLKDB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|