C13H18N2O — CID 155148654
2-methoxy-1-N,1-N-bis(prop-2-enyl)benzene-1,4-diamine (PubChem CID 155148654) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-methoxy-1-N,1-N-bis(prop-2-enyl)benzene-1,4-diamine.
| Compound Name | 2-methoxy-1-N,1-N-bis(prop-2-enyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 155148654 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-methoxy-1-N,1-N-bis(prop-2-enyl)benzene-1,4-diamine |
| SMILES | C=CCN(CC=C)c1ccc(N)cc1OC |
| InChI | InChI=1S/C13H18N2O/c1-4-8-15(9-5-2)12-7-6-11(14)10-13(12)16-3/h4-7,10H,1-2,8-9,14H2,3H3 |
| InChIKey | KYBXAVCFZZCGHG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|