C27H27ClN2O4 — CID 11397441
6,7-dimethoxy-3-methyl-2-(3-nitrophenyl)-1-(4-propan-2-ylphenyl)isoquinolin-2-ium chloride (PubChem CID 11397441) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is 6,7-dimethoxy-3-methyl-2-(3-nitrophenyl)-1-(4-propan-2-ylphenyl)isoquinolin-2-ium chloride.
| Compound Name | 6,7-dimethoxy-3-methyl-2-(3-nitrophenyl)-1-(4-propan-2-ylphenyl)isoquinolin-2-ium chloride |
|---|---|
| PubChem CID | 11397441 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 6,7-dimethoxy-3-methyl-2-(3-nitrophenyl)-1-(4-propan-2-ylphenyl)isoquinolin-2-ium chloride |
| SMILES | COc1cc2cc(C)[n+](-c3cccc([N+](=O)[O-])c3)c(-c3ccc(C(C)C)cc3)c2cc1OC.[Cl-] |
| InChI | InChI=1S/C27H27N2O4.ClH/c1-17(2)19-9-11-20(12-10-19)27-24-16-26(33-5)25(32-4)14-21(24)13-18(3)28(27)22-7-6-8-23(15-22)29(30)31;/h6-17H,1-5H3;1H/q+1;/p-1 |
| InChIKey | IUBKYTWZSMYJIM-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 65.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|