C25H20O3 — CID 102192327
(6,7-dimethoxy-2-phenylnaphthalen-1-yl)-phenylmethanone (PubChem CID 102192327) has the molecular formula C25H20O3 and a molecular weight of 368.43 g/mol. Its IUPAC name is (6,7-dimethoxy-2-phenylnaphthalen-1-yl)-phenylmethanone.
| Compound Name | (6,7-dimethoxy-2-phenylnaphthalen-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 102192327 |
| Molecular Formula | C25H20O3 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (6,7-dimethoxy-2-phenylnaphthalen-1-yl)-phenylmethanone |
| SMILES | COc1cc2ccc(-c3ccccc3)c(C(=O)c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C25H20O3/c1-27-22-15-19-13-14-20(17-9-5-3-6-10-17)24(21(19)16-23(22)28-2)25(26)18-11-7-4-8-12-18/h3-16H,1-2H3 |
| InChIKey | FREAYCWTUFLEGD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |