C22H24NO2+ — CID 123528332
2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium (PubChem CID 123528332) has the molecular formula C22H24NO2+ and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium.
| Compound Name | 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 123528332 |
| Molecular Formula | C22H24NO2+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium |
| SMILES | COc1cc2cc(-c3cc(C)cc[n+]3C)ccc2c(C2CC2)c1OC |
| InChI | InChI=1S/C22H24NO2/c1-14-9-10-23(2)19(11-14)16-7-8-18-17(12-16)13-20(24-3)22(25-4)21(18)15-5-6-15/h7-13,15H,5-6H2,1-4H3/q+1 |
| InChIKey | VBLNTPBUNOGNNQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|