About 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium
2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium (PubChem CID 123528332) has the molecular formula C22H24NO2+
and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium.
Molecular Properties
| Compound Name | 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium |
| PubChem CID | 123528332 |
| Molecular Formula | C22H24NO2+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium |
| SMILES | COc1cc2cc(-c3cc(C)cc[n+]3C)ccc2c(C2CC2)c1OC |
| InChI | InChI=1S/C22H24NO2/c1-14-9-10-23(2)19(11-14)16-7-8-18-17(12-16)13-20(24-3)22(25-4)21(18)15-5-6-15/h7-13,15H,5-6H2,1-4H3/q+1 |
| InChIKey | VBLNTPBUNOGNNQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium?
The IUPAC name of 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium (CID 123528332) is 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium.
What is the SMILES notation for 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium?
The canonical SMILES for 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium is COc1cc2cc(-c3cc(C)cc[n+]3C)ccc2c(C2CC2)c1OC.
What is the InChIKey of 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium?
The InChIKey is VBLNTPBUNOGNNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24NO2/c1-14-9-10-23(2)19(11-14)16-7-8-18-17(12-16)13-20(24-3)22(25-4)21(18)15-5-6-15/h7-13,15H,5-6H2,1-4H3/q+1.
What are the key properties of 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium?
2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium has a molecular weight of 334.44 g/mol, XLogP of 4.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyclopropyl-6,7-dimethoxynaphthalen-2-yl)-1,4-dimethylpyridin-1-ium is sourced from PubChem (CID 123528332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).