C34H30NO4+ — CID 71456824
2,3,10,11-tetramethoxy-8-methyl-12-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium (PubChem CID 71456824) has the molecular formula C34H30NO4+ and a molecular weight of 516.62 g/mol. Its IUPAC name is 2,3,10,11-tetramethoxy-8-methyl-12-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium.
| Compound Name | 2,3,10,11-tetramethoxy-8-methyl-12-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium |
|---|---|
| PubChem CID | 71456824 |
| Molecular Formula | C34H30NO4+ |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 2,3,10,11-tetramethoxy-8-methyl-12-(4-phenylphenyl)isoquinolino[2,1-b]isoquinolin-7-ium |
| SMILES | COc1cc2cc[n+]3c(C)c4cc(OC)c(OC)c(-c5ccc(-c6ccccc6)cc5)c4cc3c2cc1OC |
| InChI | InChI=1S/C34H30NO4/c1-21-26-19-32(38-4)34(39-5)33(24-13-11-23(12-14-24)22-9-7-6-8-10-22)28(26)18-29-27-20-31(37-3)30(36-2)17-25(27)15-16-35(21)29/h6-20H,1-5H3/q+1 |
| InChIKey | YVSMMLBCZIVTSL-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 41.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|